C15H23N3 — CID 139420142
(6Z,8E)-6-ethyl-8-piperidin-1-yl-5,10-dihydro-1,4-diazecine (PubChem CID 139420142) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (6Z,8E)-6-ethyl-8-piperidin-1-yl-5,10-dihydro-1,4-diazecine.
| Compound Name | (6Z,8E)-6-ethyl-8-piperidin-1-yl-5,10-dihydro-1,4-diazecine |
|---|---|
| PubChem CID | 139420142 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (6Z,8E)-6-ethyl-8-piperidin-1-yl-5,10-dihydro-1,4-diazecine |
| SMILES | CC/C1=C/C(N2CCCCC2)=C\C/N=C\C=N/C1 |
| InChI | InChI=1S/C15H23N3/c1-2-14-12-15(18-10-4-3-5-11-18)6-7-16-8-9-17-13-14/h6,8-9,12H,2-5,7,10-11,13H2,1H3/b14-12-,15-6+,16-8-,17-9- |
| InChIKey | ABLPKQHGOINFPF-PJROENFPSA-N |
| XLogP | 2.85 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |