About ethane;methane;5-piperidin-1-yl-3H-azepine
ethane;methane;5-piperidin-1-yl-3H-azepine (PubChem CID 143115625) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;methane;5-piperidin-1-yl-3H-azepine.
Molecular Properties
| Compound Name | ethane;methane;5-piperidin-1-yl-3H-azepine |
| PubChem CID | 143115625 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;methane;5-piperidin-1-yl-3H-azepine |
| SMILES | C.C1=CC(N2CCCCC2)=CCC=N1.CC |
| InChI | InChI=1S/C11H16N2.C2H6.CH4/c1-2-9-13(10-3-1)11-5-4-7-12-8-6-11;1-2;/h5-8H,1-4,9-10H2;1-2H3;1H4 |
| InChIKey | VMQXIOHDLQDCRU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methane;5-piperidin-1-yl-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;5-piperidin-1-yl-3H-azepine?
The IUPAC name of ethane;methane;5-piperidin-1-yl-3H-azepine (CID 143115625) is ethane;methane;5-piperidin-1-yl-3H-azepine.
What is the SMILES notation for ethane;methane;5-piperidin-1-yl-3H-azepine?
The canonical SMILES for ethane;methane;5-piperidin-1-yl-3H-azepine is C.C1=CC(N2CCCCC2)=CCC=N1.CC.
What is the InChIKey of ethane;methane;5-piperidin-1-yl-3H-azepine?
The InChIKey is VMQXIOHDLQDCRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.C2H6.CH4/c1-2-9-13(10-3-1)11-5-4-7-12-8-6-11;1-2;/h5-8H,1-4,9-10H2;1-2H3;1H4.
What are the key properties of ethane;methane;5-piperidin-1-yl-3H-azepine?
ethane;methane;5-piperidin-1-yl-3H-azepine has a molecular weight of 222.38 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;5-piperidin-1-yl-3H-azepine is sourced from PubChem (CID 143115625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).