C13H22N2 — CID 143115633
N-methyl-N-(3-methylpentyl)-3H-azepin-5-amine (PubChem CID 143115633) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-methyl-N-(3-methylpentyl)-3H-azepin-5-amine.
| Compound Name | N-methyl-N-(3-methylpentyl)-3H-azepin-5-amine |
|---|---|
| PubChem CID | 143115633 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-methyl-N-(3-methylpentyl)-3H-azepin-5-amine |
| SMILES | CCC(C)CCN(C)C1=CCC=NC=C1 |
| InChI | InChI=1S/C13H22N2/c1-4-12(2)8-11-15(3)13-6-5-9-14-10-7-13/h6-7,9-10,12H,4-5,8,11H2,1-3H3 |
| InChIKey | JAEIEUBQIFBLJM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |