C10H16N2 — CID 142206849
2-(3H-azepin-4-yl)-N,N-dimethylethanamine (PubChem CID 142206849) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-(3H-azepin-4-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(3H-azepin-4-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 142206849 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-(3H-azepin-4-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1=CC=CN=CC1 |
| InChI | InChI=1S/C10H16N2/c1-12(2)9-6-10-4-3-7-11-8-5-10/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | OZFYNCYQMXEQFQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |