C13H22N2 — CID 142257717
N-[2-(3H-azepin-5-yl)ethyl]-N-methylbutan-1-amine (PubChem CID 142257717) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[2-(3H-azepin-5-yl)ethyl]-N-methylbutan-1-amine.
| Compound Name | N-[2-(3H-azepin-5-yl)ethyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 142257717 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-[2-(3H-azepin-5-yl)ethyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)CCC1=CCC=NC=C1 |
| InChI | InChI=1S/C13H22N2/c1-3-4-11-15(2)12-8-13-6-5-9-14-10-7-13/h6-7,9-10H,3-5,8,11-12H2,1-2H3 |
| InChIKey | NASZPYDQASZWAR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |