About 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide
1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide (PubChem CID 87631280) has the molecular formula C12H15BrN2
and a molecular weight of 267.17 g/mol. Its IUPAC name is 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide.
Molecular Properties
| Compound Name | 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide |
| PubChem CID | 87631280 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide |
| SMILES | CCN1C=CC(=C2C=CN=CC2)[CH+]C1.[Br-] |
| InChI | InChI=1S/C12H15N2.BrH/c1-2-14-9-5-12(6-10-14)11-3-7-13-8-4-11;/h3,5-9H,2,4,10H2,1H3;1H/q+1;/p-1 |
| InChIKey | SNLSCLGPUCJULV-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide?
The IUPAC name of 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide (CID 87631280) is 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide.
What is the SMILES notation for 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide?
The canonical SMILES for 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide is CCN1C=CC(=C2C=CN=CC2)[CH+]C1.[Br-].
What is the InChIKey of 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide?
The InChIKey is SNLSCLGPUCJULV-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H15N2.BrH/c1-2-14-9-5-12(6-10-14)11-3-7-13-8-4-11;/h3,5-9H,2,4,10H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide?
1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide has a molecular weight of 267.17 g/mol, XLogP of -0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(3H-pyridin-4-ylidene)-2,3-dihydropyridin-3-ylium bromide is sourced from PubChem (CID 87631280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).