C13H22N2 — CID 123334554
N-butyl-N,6,6-trimethylazepin-4-amine (PubChem CID 123334554) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-butyl-N,6,6-trimethylazepin-4-amine.
| Compound Name | N-butyl-N,6,6-trimethylazepin-4-amine |
|---|---|
| PubChem CID | 123334554 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-butyl-N,6,6-trimethylazepin-4-amine |
| SMILES | CCCCN(C)C1=CC(C)(C)C=NC=C1 |
| InChI | InChI=1S/C13H22N2/c1-5-6-9-15(4)12-7-8-14-11-13(2,3)10-12/h7-8,10-11H,5-6,9H2,1-4H3 |
| InChIKey | CIACNODZZLPTCZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |