C12H16N2 — CID 91546937
3-ethenyl-N-methyl-4-methylidene-N'-prop-1-enylpent-2-ene-1,5-diimine (PubChem CID 91546937) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-ethenyl-N-methyl-4-methylidene-N'-prop-1-enylpent-2-ene-1,5-diimine.
| Compound Name | 3-ethenyl-N-methyl-4-methylidene-N'-prop-1-enylpent-2-ene-1,5-diimine |
|---|---|
| PubChem CID | 91546937 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-ethenyl-N-methyl-4-methylidene-N'-prop-1-enylpent-2-ene-1,5-diimine |
| SMILES | C=CC(=C/C=N/C)C(=C)/C=N/C=CC |
| InChI | InChI=1S/C12H16N2/c1-5-8-14-10-11(3)12(6-2)7-9-13-4/h5-10H,2-3H2,1,4H3/b8-5?,12-7?,13-9+,14-10+ |
| InChIKey | DPKBIGYPXYWWFX-TXARNHQBSA-N |
| XLogP | 2.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|