C13H20N2 — CID 123269294
5-(4-ethylpiperidin-1-yl)-3H-azepine (PubChem CID 123269294) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 5-(4-ethylpiperidin-1-yl)-3H-azepine.
| Compound Name | 5-(4-ethylpiperidin-1-yl)-3H-azepine |
|---|---|
| PubChem CID | 123269294 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 5-(4-ethylpiperidin-1-yl)-3H-azepine |
| SMILES | CCC1CCN(C2=CCC=NC=C2)CC1 |
| InChI | InChI=1S/C13H20N2/c1-2-12-6-10-15(11-7-12)13-4-3-8-14-9-5-13/h4-5,8-9,12H,2-3,6-7,10-11H2,1H3 |
| InChIKey | HUMRRVHKHNIULN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |