C29H32N6O2 — CID 139426035
3-[2-(4-cyanophenyl)ethylamino]-N-[5-(4-methyl-5-oxo-1,4-diazepan-1-yl)-2-pyridinyl]-2-phenylpropanamide (PubChem CID 139426035) has the molecular formula C29H32N6O2 and a molecular weight of 496.62 g/mol. Its IUPAC name is 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(4-methyl-5-oxo-1,4-diazepan-1-yl)-2-pyridinyl]-2-phenylpropanamide.
| Compound Name | 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(4-methyl-5-oxo-1,4-diazepan-1-yl)-2-pyridinyl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 139426035 |
| Molecular Formula | C29H32N6O2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(4-methyl-5-oxo-1,4-diazepan-1-yl)-2-pyridinyl]-2-phenylpropanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)C(CNCCc3ccc(C#N)cc3)c3ccccc3)nc2)CCC1=O |
| InChI | InChI=1S/C29H32N6O2/c1-34-17-18-35(16-14-28(34)36)25-11-12-27(32-20-25)33-29(37)26(24-5-3-2-4-6-24)21-31-15-13-22-7-9-23(19-30)10-8-22/h2-12,20,26,31H,13-18,21H2,1H3,(H,32,33,37) |
| InChIKey | DDKTVMFYULBGTQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|