C27H26N6O — CID 139426172
3-[2-(4-cyanophenyl)ethylamino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylpropanamide (PubChem CID 139426172) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylpropanamide.
| Compound Name | 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 139426172 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylpropanamide |
| SMILES | Cn1cc(-c2ccc(NC(=O)C(CNCCc3ccc(C#N)cc3)c3ccccc3)nc2)cn1 |
| InChI | InChI=1S/C27H26N6O/c1-33-19-24(17-31-33)23-11-12-26(30-16-23)32-27(34)25(22-5-3-2-4-6-22)18-29-14-13-20-7-9-21(15-28)10-8-20/h2-12,16-17,19,25,29H,13-14,18H2,1H3,(H,30,32,34) |
| InChIKey | BMLCTPPCXRBUPA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|