C32H36N6O — CID 139426164
2-[2-(4-cyanophenyl)ethylamino]-2-(3-hexylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]acetamide (PubChem CID 139426164) has the molecular formula C32H36N6O and a molecular weight of 520.68 g/mol. Its IUPAC name is 2-[2-(4-cyanophenyl)ethylamino]-2-(3-hexylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]acetamide.
| Compound Name | 2-[2-(4-cyanophenyl)ethylamino]-2-(3-hexylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 139426164 |
| Molecular Formula | C32H36N6O |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 2-[2-(4-cyanophenyl)ethylamino]-2-(3-hexylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]acetamide |
| SMILES | CCCCCCc1cccc(C(NCCc2ccc(C#N)cc2)C(=O)Nc2ccc(-c3cnn(C)c3)cn2)c1 |
| InChI | InChI=1S/C32H36N6O/c1-3-4-5-6-8-25-9-7-10-27(19-25)31(34-18-17-24-11-13-26(20-33)14-12-24)32(39)37-30-16-15-28(21-35-30)29-22-36-38(2)23-29/h7,9-16,19,21-23,31,34H,3-6,8,17-18H2,1-2H3,(H,35,37,39) |
| InChIKey | UOIREGCXKYILFI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|