C28H27N5O — CID 158240916
5-(4-cyanophenyl)-2-(3-methylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]pentanamide (PubChem CID 158240916) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is 5-(4-cyanophenyl)-2-(3-methylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]pentanamide.
| Compound Name | 5-(4-cyanophenyl)-2-(3-methylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 158240916 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 5-(4-cyanophenyl)-2-(3-methylphenyl)-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]pentanamide |
| SMILES | Cc1cccc(C(CCCc2ccc(C#N)cc2)C(=O)Nc2ccc(-c3cnn(C)c3)cn2)c1 |
| InChI | InChI=1S/C28H27N5O/c1-20-5-3-7-23(15-20)26(8-4-6-21-9-11-22(16-29)12-10-21)28(34)32-27-14-13-24(17-30-27)25-18-31-33(2)19-25/h3,5,7,9-15,17-19,26H,4,6,8H2,1-2H3,(H,30,32,34) |
| InChIKey | GFNKIMUDGXKXSK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |