C26H25N7O — CID 139426043
3-[2-(4-cyanophenyl)ethylamino]-N-[5-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-2-phenylpropanamide (PubChem CID 139426043) has the molecular formula C26H25N7O and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-2-phenylpropanamide.
| Compound Name | 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-2-phenylpropanamide |
|---|---|
| PubChem CID | 139426043 |
| Molecular Formula | C26H25N7O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[2-(4-cyanophenyl)ethylamino]-N-[5-(3-methyl-1,2,4-triazol-1-yl)-2-pyridinyl]-2-phenylpropanamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)C(CNCCc3ccc(C#N)cc3)c3ccccc3)nc2)n1 |
| InChI | InChI=1S/C26H25N7O/c1-19-30-18-33(32-19)23-11-12-25(29-16-23)31-26(34)24(22-5-3-2-4-6-22)17-28-14-13-20-7-9-21(15-27)10-8-20/h2-12,16,18,24,28H,13-14,17H2,1H3,(H,29,31,34) |
| InChIKey | WNFBOGDPDYUMLM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|