C12H7Cl2N3OS — CID 139427260
8-(2,3-dichlorophenyl)sulfanyl-6H-imidazo[1,2-c]pyrimidin-5-one (PubChem CID 139427260) has the molecular formula C12H7Cl2N3OS and a molecular weight of 312.18 g/mol. Its IUPAC name is 8-(2,3-dichlorophenyl)sulfanyl-6H-imidazo[1,2-c]pyrimidin-5-one.
| Compound Name | 8-(2,3-dichlorophenyl)sulfanyl-6H-imidazo[1,2-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 139427260 |
| Molecular Formula | C12H7Cl2N3OS |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 8-(2,3-dichlorophenyl)sulfanyl-6H-imidazo[1,2-c]pyrimidin-5-one |
| SMILES | O=c1[nH]cc(Sc2cccc(Cl)c2Cl)c2nccn12 |
| InChI | InChI=1S/C12H7Cl2N3OS/c13-7-2-1-3-8(10(7)14)19-9-6-16-12(18)17-5-4-15-11(9)17/h1-6H,(H,16,18) |
| InChIKey | JOBNVAJVRPWLGJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |