C24H27ClN6OS — CID 139427329
N-[3-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]prop-2-enamide (PubChem CID 139427329) has the molecular formula C24H27ClN6OS and a molecular weight of 483.04 g/mol. Its IUPAC name is N-[3-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]prop-2-enamide.
| Compound Name | N-[3-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139427329 |
| Molecular Formula | C24H27ClN6OS |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[3-[5-[(4R)-4-amino-8-azaspiro[4.5]decan-8-yl]imidazo[1,2-c]pyrimidin-8-yl]sulfanyl-2-chlorophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Sc2cnc(N3CCC4(CCC[C@H]4N)CC3)n3ccnc23)c1Cl |
| InChI | InChI=1S/C24H27ClN6OS/c1-2-20(32)29-16-5-3-6-17(21(16)25)33-18-15-28-23(31-14-11-27-22(18)31)30-12-9-24(10-13-30)8-4-7-19(24)26/h2-3,5-6,11,14-15,19H,1,4,7-10,12-13,26H2,(H,29,32)/t19-/m1/s1 |
| InChIKey | VNGUIRGUYKTODY-LJQANCHMSA-N |
| XLogP | 4.76 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|