C24H33BrN4O2 — CID 139431399
5-bromo-1-(oxan-2-yl)-N-[4-(pyrrolidin-1-ylmethyl)cyclohexyl]indazole-3-carboxamide (PubChem CID 139431399) has the molecular formula C24H33BrN4O2 and a molecular weight of 489.46 g/mol. Its IUPAC name is 5-bromo-1-(oxan-2-yl)-N-[4-(pyrrolidin-1-ylmethyl)cyclohexyl]indazole-3-carboxamide.
| Compound Name | 5-bromo-1-(oxan-2-yl)-N-[4-(pyrrolidin-1-ylmethyl)cyclohexyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 139431399 |
| Molecular Formula | C24H33BrN4O2 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 5-bromo-1-(oxan-2-yl)-N-[4-(pyrrolidin-1-ylmethyl)cyclohexyl]indazole-3-carboxamide |
| SMILES | O=C(NC1CCC(CN2CCCC2)CC1)c1nn(C2CCCCO2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C24H33BrN4O2/c25-18-8-11-21-20(15-18)23(27-29(21)22-5-1-4-14-31-22)24(30)26-19-9-6-17(7-10-19)16-28-12-2-3-13-28/h8,11,15,17,19,22H,1-7,9-10,12-14,16H2,(H,26,30) |
| InChIKey | YBXZEYXMVCCJNJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |