C24H32NO2+ — CID 1394316
2-[(3R)-3-[hydroxy-bis(2-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanol (PubChem CID 1394316) has the molecular formula C24H32NO2+ and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-[(3R)-3-[hydroxy-bis(2-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanol.
| Compound Name | 2-[(3R)-3-[hydroxy-bis(2-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanol |
|---|---|
| PubChem CID | 1394316 |
| Molecular Formula | C24H32NO2+ |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-[(3R)-3-[hydroxy-bis(2-methylphenyl)methyl]-1-azoniabicyclo[2.2.2]octan-1-yl]ethanol |
| SMILES | Cc1ccccc1C(O)(c1ccccc1C)[C@H]1C[N+]2(CCO)CCC1CC2 |
| InChI | InChI=1S/C24H32NO2/c1-18-7-3-5-9-21(18)24(27,22-10-6-4-8-19(22)2)23-17-25(15-16-26)13-11-20(23)12-14-25/h3-10,20,23,26-27H,11-17H2,1-2H3/q+1/t20?,23-,25?/m0/s1 |
| InChIKey | SLCQLNSVRAOWMA-KOXWRSSLSA-N |
| XLogP | 3.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|