C15H22BrNOS — CID 17368352
(1-propyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-2-ylmethanone bromide (PubChem CID 17368352) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is (1-propyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-2-ylmethanone bromide.
| Compound Name | (1-propyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-2-ylmethanone bromide |
|---|---|
| PubChem CID | 17368352 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (1-propyl-1-azoniabicyclo[2.2.2]octan-3-yl)-thiophen-2-ylmethanone bromide |
| SMILES | CCC[N+]12CCC(CC1)C(C(=O)c1cccs1)C2.[Br-] |
| InChI | InChI=1S/C15H22NOS.BrH/c1-2-7-16-8-5-12(6-9-16)13(11-16)15(17)14-4-3-10-18-14;/h3-4,10,12-13H,2,5-9,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | UBMQVSDKZUBHSA-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|