C11H11N3O4S — CID 139434719
formic acid;N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 139434719) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is formic acid;N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | formic acid;N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 139434719 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | formic acid;N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | O=CO.O=S(=O)(Nc1ccncn1)c1ccccc1 |
| InChI | InChI=1S/C10H9N3O2S.CH2O2/c14-16(15,9-4-2-1-3-5-9)13-10-6-7-11-8-12-10;2-1-3/h1-8H,(H,11,12,13);1H,(H,2,3) |
| InChIKey | QCFPNSHYRDRORU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|