C25H35N3O — CID 139437842
N-[3-(1,3-dihydroisoindol-2-yl)propyl]-3-(heptan-4-ylamino)benzamide (PubChem CID 139437842) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is N-[3-(1,3-dihydroisoindol-2-yl)propyl]-3-(heptan-4-ylamino)benzamide.
| Compound Name | N-[3-(1,3-dihydroisoindol-2-yl)propyl]-3-(heptan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 139437842 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | N-[3-(1,3-dihydroisoindol-2-yl)propyl]-3-(heptan-4-ylamino)benzamide |
| SMILES | CCCC(CCC)Nc1cccc(C(=O)NCCCN2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C25H35N3O/c1-3-9-23(10-4-2)27-24-14-7-13-20(17-24)25(29)26-15-8-16-28-18-21-11-5-6-12-22(21)19-28/h5-7,11-14,17,23,27H,3-4,8-10,15-16,18-19H2,1-2H3,(H,26,29) |
| InChIKey | DYVQEEJVICHIFA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|