C21H29F2NO7 — CID 139438477
(3S)-6-[1,1-difluoro-2-[[6-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-5-yl]amino]ethyl]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 139438477) has the molecular formula C21H29F2NO7 and a molecular weight of 445.46 g/mol. Its IUPAC name is (3S)-6-[1,1-difluoro-2-[[6-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-5-yl]amino]ethyl]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (3S)-6-[1,1-difluoro-2-[[6-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-5-yl]amino]ethyl]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 139438477 |
| Molecular Formula | C21H29F2NO7 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (3S)-6-[1,1-difluoro-2-[[6-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-5-yl]amino]ethyl]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | COCC1CCc2cc3c(cc2C1NCC(F)(F)C1CC(O)[C@H](O)C(CO)O1)OCO3 |
| InChI | InChI=1S/C21H29F2NO7/c1-28-8-12-3-2-11-4-15-16(30-10-29-15)5-13(11)19(12)24-9-21(22,23)18-6-14(26)20(27)17(7-25)31-18/h4-5,12,14,17-20,24-27H,2-3,6-10H2,1H3/t12?,14?,17?,18?,19?,20-/m0/s1 |
| InChIKey | RLVPZGNOMKBDQD-VYPRGMSDSA-N |
| XLogP | 0.76 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |