C32H35F3N4O9 — CID 145365682
[5-[[(Z)-2-amino-3-[N-amino-4-(trifluoromethoxy)anilino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene (PubChem CID 145365682) has the molecular formula C32H35F3N4O9 and a molecular weight of 676.65 g/mol. Its IUPAC name is [5-[[(Z)-2-amino-3-[N-amino-4-(trifluoromethoxy)anilino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene.
| Compound Name | [5-[[(Z)-2-amino-3-[N-amino-4-(trifluoromethoxy)anilino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 145365682 |
| Molecular Formula | C32H35F3N4O9 |
| Molecular Weight | 676.65 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | [5-[[(Z)-2-amino-3-[N-amino-4-(trifluoromethoxy)anilino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene |
| SMILES | COc1cccc(OC)c1OC.N/C(=C\N(N)c1ccc(OC(F)(F)F)cc1)C(=O)NC1c2cc3c(cc2CCC1COC=O)OCO3 |
| InChI | InChI=1S/C23H23F3N4O6.C9H12O3/c24-23(25,26)36-16-5-3-15(4-6-16)30(28)9-18(27)22(32)29-21-14(10-33-11-31)2-1-13-7-19-20(8-17(13)21)35-12-34-19;1-10-7-5-4-6-8(11-2)9(7)12-3/h3-9,11,14,21H,1-2,10,12,27-28H2,(H,29,32);4-6H,1-3H3/b18-9-; |
| InChIKey | HUYCEZLPEFGMCK-NAIZSXBXSA-N |
| XLogP | 4.10 |
| TPSA | 166.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|