C34H42N4O11 — CID 145365657
[5-[[(Z)-2-amino-3-(N-amino-3,4,5-trimethoxyanilino)prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene (PubChem CID 145365657) has the molecular formula C34H42N4O11 and a molecular weight of 682.73 g/mol. Its IUPAC name is [5-[[(Z)-2-amino-3-(N-amino-3,4,5-trimethoxyanilino)prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene.
| Compound Name | [5-[[(Z)-2-amino-3-(N-amino-3,4,5-trimethoxyanilino)prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 145365657 |
| Molecular Formula | C34H42N4O11 |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | [5-[[(Z)-2-amino-3-(N-amino-3,4,5-trimethoxyanilino)prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene |
| SMILES | COc1cc(N(N)/C=C(\N)C(=O)NC2c3cc4c(cc3CCC2COC=O)OCO4)cc(OC)c1OC.COc1cccc(OC)c1OC |
| InChI | InChI=1S/C25H30N4O8.C9H12O3/c1-32-21-7-16(8-22(33-2)24(21)34-3)29(27)10-18(26)25(31)28-23-15(11-35-12-30)5-4-14-6-19-20(9-17(14)23)37-13-36-19;1-10-7-5-4-6-8(11-2)9(7)12-3/h6-10,12,15,23H,4-5,11,13,26-27H2,1-3H3,(H,28,31);4-6H,1-3H3/b18-10-; |
| InChIKey | RGLIBDSLIDAEID-LFYAFSDUSA-N |
| XLogP | 3.23 |
| TPSA | 184.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|