C24H22F2N4O5 — CID 163439289
[(6S)-5-[[1-[(3,4-difluorophenyl)methyl]triazole-4-carbonyl]-methylamino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate (PubChem CID 163439289) has the molecular formula C24H22F2N4O5 and a molecular weight of 484.46 g/mol. Its IUPAC name is [(6S)-5-[[1-[(3,4-difluorophenyl)methyl]triazole-4-carbonyl]-methylamino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate.
| Compound Name | [(6S)-5-[[1-[(3,4-difluorophenyl)methyl]triazole-4-carbonyl]-methylamino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate |
|---|---|
| PubChem CID | 163439289 |
| Molecular Formula | C24H22F2N4O5 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [(6S)-5-[[1-[(3,4-difluorophenyl)methyl]triazole-4-carbonyl]-methylamino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate |
| SMILES | CN(C(=O)c1cn(Cc2ccc(F)c(F)c2)nn1)C1c2cc3c(cc2CC[C@@H]1COC=O)OCO3 |
| InChI | InChI=1S/C24H22F2N4O5/c1-29(24(32)20-10-30(28-27-20)9-14-2-5-18(25)19(26)6-14)23-16(11-33-12-31)4-3-15-7-21-22(8-17(15)23)35-13-34-21/h2,5-8,10,12,16,23H,3-4,9,11,13H2,1H3/t16-,23?/m1/s1 |
| InChIKey | AXDUKHORJULLSI-ADRQNKRLSA-N |
| XLogP | 2.88 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|