C33H40N4O8 — CID 145365644
[5-[[(Z)-2-amino-3-[amino-[(3-methylphenyl)methyl]amino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene (PubChem CID 145365644) has the molecular formula C33H40N4O8 and a molecular weight of 620.70 g/mol. Its IUPAC name is [5-[[(Z)-2-amino-3-[amino-[(3-methylphenyl)methyl]amino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene.
| Compound Name | [5-[[(Z)-2-amino-3-[amino-[(3-methylphenyl)methyl]amino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 145365644 |
| Molecular Formula | C33H40N4O8 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | [5-[[(Z)-2-amino-3-[amino-[(3-methylphenyl)methyl]amino]prop-2-enoyl]amino]-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl formate;1,2,3-trimethoxybenzene |
| SMILES | COc1cccc(OC)c1OC.Cc1cccc(CN(N)/C=C(\N)C(=O)NC2c3cc4c(cc3CCC2COC=O)OCO4)c1 |
| InChI | InChI=1S/C24H28N4O5.C9H12O3/c1-15-3-2-4-16(7-15)10-28(26)11-20(25)24(30)27-23-18(12-31-13-29)6-5-17-8-21-22(9-19(17)23)33-14-32-21;1-10-7-5-4-6-8(11-2)9(7)12-3/h2-4,7-9,11,13,18,23H,5-6,10,12,14,25-26H2,1H3,(H,27,30);4-6H,1-3H3/b20-11-; |
| InChIKey | LQJPPKUQJSYEFV-FZLYBSHOSA-N |
| XLogP | 3.50 |
| TPSA | 156.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|