C11H11Cl2NO2S — CID 139440669
2-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-yl]acetic acid (PubChem CID 139440669) has the molecular formula C11H11Cl2NO2S and a molecular weight of 292.19 g/mol. Its IUPAC name is 2-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-yl]acetic acid.
| Compound Name | 2-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 139440669 |
| Molecular Formula | C11H11Cl2NO2S |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-[2-(2,3-dichlorophenyl)-1,3-thiazolidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CSC(c2cccc(Cl)c2Cl)N1 |
| InChI | InChI=1S/C11H11Cl2NO2S/c12-8-3-1-2-7(10(8)13)11-14-6(5-17-11)4-9(15)16/h1-3,6,11,14H,4-5H2,(H,15,16) |
| InChIKey | AJPJCHCCWNIMLU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |