About N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine
N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine (PubChem CID 139441136) has the molecular formula C12H11N5
and a molecular weight of 225.26 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine |
| PubChem CID | 139441136 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine |
| SMILES | c1ccc(CNc2cnc3nc[nH]c3c2)nc1 |
| InChI | InChI=1S/C12H11N5/c1-2-4-13-9(3-1)6-14-10-5-11-12(15-7-10)17-8-16-11/h1-5,7-8,14H,6H2,(H,15,16,17) |
| InChIKey | MTMJKNYTVCSBPB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine?
The IUPAC name of N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine (CID 139441136) is N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine.
What is the SMILES notation for N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine?
The canonical SMILES for N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine is c1ccc(CNc2cnc3nc[nH]c3c2)nc1.
What is the InChIKey of N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine?
The InChIKey is MTMJKNYTVCSBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c1-2-4-13-9(3-1)6-14-10-5-11-12(15-7-10)17-8-16-11/h1-5,7-8,14H,6H2,(H,15,16,17).
What are the key properties of N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine?
N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine has a molecular weight of 225.26 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(pyridin-2-ylmethyl)-1H-imidazo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 139441136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).