C9H15NS — CID 139443844
[(2E,4Z)-hexa-2,4-dien-2-yl] N-ethylmethanimidothioate (PubChem CID 139443844) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is [(2E,4Z)-hexa-2,4-dien-2-yl] N-ethylmethanimidothioate.
| Compound Name | [(2E,4Z)-hexa-2,4-dien-2-yl] N-ethylmethanimidothioate |
|---|---|
| PubChem CID | 139443844 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | [(2E,4Z)-hexa-2,4-dien-2-yl] N-ethylmethanimidothioate |
| SMILES | C/C=C\C=C(/C)S/C=N/CC |
| InChI | InChI=1S/C9H15NS/c1-4-6-7-9(3)11-8-10-5-2/h4,6-8H,5H2,1-3H3/b6-4-,9-7+,10-8+ |
| InChIKey | OJDLCKHNTXHBCL-DILYWIELSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|