C10H19NS — CID 142189695
ethane;(2Z,4E)-N-methyl-4-methylsulfanylhexa-2,4-dien-1-imine (PubChem CID 142189695) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is ethane;(2Z,4E)-N-methyl-4-methylsulfanylhexa-2,4-dien-1-imine.
| Compound Name | ethane;(2Z,4E)-N-methyl-4-methylsulfanylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142189695 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | ethane;(2Z,4E)-N-methyl-4-methylsulfanylhexa-2,4-dien-1-imine |
| SMILES | C/C=C(\C=C/C=N/C)SC.CC |
| InChI | InChI=1S/C8H13NS.C2H6/c1-4-8(10-3)6-5-7-9-2;1-2/h4-7H,1-3H3;1-2H3/b6-5-,8-4+,9-7+; |
| InChIKey | UWPPGCVEFJXCBX-GMERRPRKSA-N |
| XLogP | 3.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|