C8H13NS — CID 142185311
N-[(1Z,3E)-4-methylsulfanylpenta-1,3-dienyl]ethanimine (PubChem CID 142185311) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is N-[(1Z,3E)-4-methylsulfanylpenta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1Z,3E)-4-methylsulfanylpenta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 142185311 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | N-[(1Z,3E)-4-methylsulfanylpenta-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C\C=C(/C)SC |
| InChI | InChI=1S/C8H13NS/c1-4-9-7-5-6-8(2)10-3/h4-7H,1-3H3/b7-5-,8-6+,9-4+ |
| InChIKey | LJWNWUBVRYUWJR-JOVNBEPESA-N |
| XLogP | 2.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|