C19H29N — CID 139446704
(3R,4E,6E)-6-(2,5-dimethylphenyl)-2,2,4-trimethylocta-4,6-dien-3-amine (PubChem CID 139446704) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (3R,4E,6E)-6-(2,5-dimethylphenyl)-2,2,4-trimethylocta-4,6-dien-3-amine.
| Compound Name | (3R,4E,6E)-6-(2,5-dimethylphenyl)-2,2,4-trimethylocta-4,6-dien-3-amine |
|---|---|
| PubChem CID | 139446704 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (3R,4E,6E)-6-(2,5-dimethylphenyl)-2,2,4-trimethylocta-4,6-dien-3-amine |
| SMILES | C/C=C(\C=C(/C)[C@H](N)C(C)(C)C)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H29N/c1-8-16(12-15(4)18(20)19(5,6)7)17-11-13(2)9-10-14(17)3/h8-12,18H,20H2,1-7H3/b15-12+,16-8+/t18-/m0/s1 |
| InChIKey | DGGADGNXAOUVIG-WHUIJFCZSA-N |
| XLogP | 5.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|