C22H29N — CID 142376838
(3E,5E,6Z)-5-[2-(2,5-dimethylphenyl)prop-2-enylidene]-3-ethylidenenona-1,6-dien-4-amine (PubChem CID 142376838) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is (3E,5E,6Z)-5-[2-(2,5-dimethylphenyl)prop-2-enylidene]-3-ethylidenenona-1,6-dien-4-amine.
| Compound Name | (3E,5E,6Z)-5-[2-(2,5-dimethylphenyl)prop-2-enylidene]-3-ethylidenenona-1,6-dien-4-amine |
|---|---|
| PubChem CID | 142376838 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (3E,5E,6Z)-5-[2-(2,5-dimethylphenyl)prop-2-enylidene]-3-ethylidenenona-1,6-dien-4-amine |
| SMILES | C=C/C(=C\C)C(N)C(/C=C\CC)=C/C(=C)c1cc(C)ccc1C |
| InChI | InChI=1S/C22H29N/c1-7-10-11-20(22(23)19(8-2)9-3)15-18(6)21-14-16(4)12-13-17(21)5/h8-15,22H,2,6-7,23H2,1,3-5H3/b11-10-,19-9+,20-15+ |
| InChIKey | PXWHDJGZNGEMNS-AQXNUROPSA-N |
| XLogP | 5.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|