C17H17N3O2 — CID 139447783
tert-butyl 2-imidazo[1,2-a]pyridin-8-ylpyridine-4-carboxylate (PubChem CID 139447783) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is tert-butyl 2-imidazo[1,2-a]pyridin-8-ylpyridine-4-carboxylate.
| Compound Name | tert-butyl 2-imidazo[1,2-a]pyridin-8-ylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 139447783 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | tert-butyl 2-imidazo[1,2-a]pyridin-8-ylpyridine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccnc(-c2cccn3ccnc23)c1 |
| InChI | InChI=1S/C17H17N3O2/c1-17(2,3)22-16(21)12-6-7-18-14(11-12)13-5-4-9-20-10-8-19-15(13)20/h4-11H,1-3H3 |
| InChIKey | SSKXGFVRJPRSMW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |