C17H17ClN4O2 — CID 151779128
tert-butyl 3-[(6-chloroimidazo[1,2-b]pyridazin-8-yl)amino]benzoate (PubChem CID 151779128) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is tert-butyl 3-[(6-chloroimidazo[1,2-b]pyridazin-8-yl)amino]benzoate.
| Compound Name | tert-butyl 3-[(6-chloroimidazo[1,2-b]pyridazin-8-yl)amino]benzoate |
|---|---|
| PubChem CID | 151779128 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | tert-butyl 3-[(6-chloroimidazo[1,2-b]pyridazin-8-yl)amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(Nc2cc(Cl)nn3ccnc23)c1 |
| InChI | InChI=1S/C17H17ClN4O2/c1-17(2,3)24-16(23)11-5-4-6-12(9-11)20-13-10-14(18)21-22-8-7-19-15(13)22/h4-10,20H,1-3H3 |
| InChIKey | RUFHHOVXHVUTMJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |