C29H32ClN3O7 — CID 139452025
[2-chloro-6-[4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butylcarbamoyl]-7-oxophenoxazin-3-yl] octanoate (PubChem CID 139452025) has the molecular formula C29H32ClN3O7 and a molecular weight of 570.04 g/mol. Its IUPAC name is [2-chloro-6-[4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butylcarbamoyl]-7-oxophenoxazin-3-yl] octanoate.
| Compound Name | [2-chloro-6-[4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butylcarbamoyl]-7-oxophenoxazin-3-yl] octanoate |
|---|---|
| PubChem CID | 139452025 |
| Molecular Formula | C29H32ClN3O7 |
| Molecular Weight | 570.04 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | [2-chloro-6-[4-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)butylcarbamoyl]-7-oxophenoxazin-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc2oc3c(C(=O)NCCCCN4C(=O)C=CC4O)c(=O)ccc-3nc2cc1Cl |
| InChI | InChI=1S/C29H32ClN3O7/c1-2-3-4-5-6-9-26(37)39-22-17-23-20(16-18(22)30)32-19-10-11-21(34)27(28(19)40-23)29(38)31-14-7-8-15-33-24(35)12-13-25(33)36/h10-13,16-17,24,35H,2-9,14-15H2,1H3,(H,31,38) |
| InChIKey | HOMPMCIOWVHBKX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.04 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|