C32H35ClN2O9S — CID 147771509
[2-chloro-6-[6-[3-(formyloxymethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]hexanoyl]-7-oxophenoxazin-3-yl] octanoate (PubChem CID 147771509) has the molecular formula C32H35ClN2O9S and a molecular weight of 659.16 g/mol. Its IUPAC name is [2-chloro-6-[6-[3-(formyloxymethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]hexanoyl]-7-oxophenoxazin-3-yl] octanoate.
| Compound Name | [2-chloro-6-[6-[3-(formyloxymethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]hexanoyl]-7-oxophenoxazin-3-yl] octanoate |
|---|---|
| PubChem CID | 147771509 |
| Molecular Formula | C32H35ClN2O9S |
| Molecular Weight | 659.16 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | [2-chloro-6-[6-[3-(formyloxymethylsulfanyl)-2,5-dioxopyrrolidin-1-yl]hexanoyl]-7-oxophenoxazin-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc2oc3c(C(=O)CCCCCN4C(=O)CC(SCOC=O)C4=O)c(=O)ccc-3nc2cc1Cl |
| InChI | InChI=1S/C32H35ClN2O9S/c1-2-3-4-5-8-11-29(40)43-25-16-26-22(15-20(25)33)34-21-12-13-24(38)30(31(21)44-26)23(37)10-7-6-9-14-35-28(39)17-27(32(35)41)45-19-42-18-36/h12-13,15-16,18,27H,2-11,14,17,19H2,1H3 |
| InChIKey | HGAGEGDCHQHUGI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 150.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.16 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|