C16H27ClO — CID 139452038
(Z,6S)-7-[(3Z)-4-chlorohexa-3,5-dien-3-yl]oxy-6,7-dimethyloct-3-ene (PubChem CID 139452038) has the molecular formula C16H27ClO and a molecular weight of 270.84 g/mol. Its IUPAC name is (Z,6S)-7-[(3Z)-4-chlorohexa-3,5-dien-3-yl]oxy-6,7-dimethyloct-3-ene.
| Compound Name | (Z,6S)-7-[(3Z)-4-chlorohexa-3,5-dien-3-yl]oxy-6,7-dimethyloct-3-ene |
|---|---|
| PubChem CID | 139452038 |
| Molecular Formula | C16H27ClO |
| Molecular Weight | 270.84 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (Z,6S)-7-[(3Z)-4-chlorohexa-3,5-dien-3-yl]oxy-6,7-dimethyloct-3-ene |
| SMILES | C=C/C(Cl)=C(\CC)OC(C)(C)[C@@H](C)C/C=C\CC |
| InChI | InChI=1S/C16H27ClO/c1-7-10-11-12-13(4)16(5,6)18-15(9-3)14(17)8-2/h8,10-11,13H,2,7,9,12H2,1,3-6H3/b11-10-,15-14-/t13-/m0/s1 |
| InChIKey | QRJSVCHLHJUMOA-DKLAKNODSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|