C14H20Cl2 — CID 170263420
(3Z,5E)-3,4-dichloro-6-ethenyl-7,7,8-trimethylnona-1,3,5-triene (PubChem CID 170263420) has the molecular formula C14H20Cl2 and a molecular weight of 259.22 g/mol. Its IUPAC name is (3Z,5E)-3,4-dichloro-6-ethenyl-7,7,8-trimethylnona-1,3,5-triene.
| Compound Name | (3Z,5E)-3,4-dichloro-6-ethenyl-7,7,8-trimethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 170263420 |
| Molecular Formula | C14H20Cl2 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (3Z,5E)-3,4-dichloro-6-ethenyl-7,7,8-trimethylnona-1,3,5-triene |
| SMILES | C=C/C(Cl)=C(Cl)\C=C(/C=C)C(C)(C)C(C)C |
| InChI | InChI=1S/C14H20Cl2/c1-7-11(14(5,6)10(3)4)9-13(16)12(15)8-2/h7-10H,1-2H2,3-6H3/b11-9+,13-12- |
| InChIKey | WQHPSHXQYUQWMV-ZFDSPDROSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|