C11H13NO2S3 — CID 139452513
3-(disulfanyl)-3-(3-ethylsulfonylphenyl)propanenitrile (PubChem CID 139452513) has the molecular formula C11H13NO2S3 and a molecular weight of 287.43 g/mol. Its IUPAC name is 3-(disulfanyl)-3-(3-ethylsulfonylphenyl)propanenitrile.
| Compound Name | 3-(disulfanyl)-3-(3-ethylsulfonylphenyl)propanenitrile |
|---|---|
| PubChem CID | 139452513 |
| Molecular Formula | C11H13NO2S3 |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-(disulfanyl)-3-(3-ethylsulfonylphenyl)propanenitrile |
| SMILES | CCS(=O)(=O)c1cccc(C(CC#N)SS)c1 |
| InChI | InChI=1S/C11H13NO2S3/c1-2-17(13,14)10-5-3-4-9(8-10)11(16-15)6-7-12/h3-5,8,11,15H,2,6H2,1H3 |
| InChIKey | NMYQSGQPTCNIEN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|