C24H28F4N4O3 — CID 139452652
[8-[(2R)-1,4-dioxan-2-yl]-3-fluoro-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol (PubChem CID 139452652) has the molecular formula C24H28F4N4O3 and a molecular weight of 496.51 g/mol. Its IUPAC name is [8-[(2R)-1,4-dioxan-2-yl]-3-fluoro-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol.
| Compound Name | [8-[(2R)-1,4-dioxan-2-yl]-3-fluoro-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 139452652 |
| Molecular Formula | C24H28F4N4O3 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | [8-[(2R)-1,4-dioxan-2-yl]-3-fluoro-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol |
| SMILES | OC(C1CCN(CC(F)(F)F)CC1)N1Cc2cc(F)cnc2Nc2ccc([C@@H]3COCCO3)cc21 |
| InChI | InChI=1S/C24H28F4N4O3/c25-18-9-17-12-32(23(33)15-3-5-31(6-4-15)14-24(26,27)28)20-10-16(21-13-34-7-8-35-21)1-2-19(20)30-22(17)29-11-18/h1-2,9-11,15,21,23,33H,3-8,12-14H2,(H,29,30)/t21-,23?/m0/s1 |
| InChIKey | LYOJTNQANQBOTI-BBQAJUCSSA-N |
| XLogP | 3.96 |
| TPSA | 70.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |