C20H20BrF3N4O — CID 121389541
(8-bromo-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone (PubChem CID 121389541) has the molecular formula C20H20BrF3N4O and a molecular weight of 469.31 g/mol. Its IUPAC name is (8-bromo-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone.
| Compound Name | (8-bromo-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 121389541 |
| Molecular Formula | C20H20BrF3N4O |
| Molecular Weight | 469.31 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | (8-bromo-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(CC(F)(F)F)CC1)N1Cc2cccnc2Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C20H20BrF3N4O/c21-15-3-4-16-17(10-15)28(11-14-2-1-7-25-18(14)26-16)19(29)13-5-8-27(9-6-13)12-20(22,23)24/h1-4,7,10,13H,5-6,8-9,11-12H2,(H,25,26) |
| InChIKey | OZXFSTZCZWUBPI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |