C25H30F3N5O2 — CID 121389831
(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]methanone (PubChem CID 121389831) has the molecular formula C25H30F3N5O2 and a molecular weight of 489.54 g/mol. Its IUPAC name is (8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]methanone.
| Compound Name | (8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 121389831 |
| Molecular Formula | C25H30F3N5O2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[1-(1,1,1-trifluoropropan-2-yl)piperidin-4-yl]methanone |
| SMILES | CC(N1CCC(C(=O)N2Cc3cccnc3Nc3ccc(N4CCOCC4)cc32)CC1)C(F)(F)F |
| InChI | InChI=1S/C25H30F3N5O2/c1-17(25(26,27)28)31-9-6-18(7-10-31)24(34)33-16-19-3-2-8-29-23(19)30-21-5-4-20(15-22(21)33)32-11-13-35-14-12-32/h2-5,8,15,17-18H,6-7,9-14,16H2,1H3,(H,29,30) |
| InChIKey | JVYDDPNJHROHSH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |