C28H34F3N5O2 — CID 121389803
[4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone (PubChem CID 121389803) has the molecular formula C28H34F3N5O2 and a molecular weight of 529.61 g/mol. Its IUPAC name is [4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone.
| Compound Name | [4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
|---|---|
| PubChem CID | 121389803 |
| Molecular Formula | C28H34F3N5O2 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | [4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
| SMILES | O=C(C1CCC(N(CC(F)(F)F)C2CC2)CC1)N1Cc2cccnc2Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C28H34F3N5O2/c29-28(30,31)18-36(22-7-8-22)21-5-3-19(4-6-21)27(37)35-17-20-2-1-11-32-26(20)33-24-10-9-23(16-25(24)35)34-12-14-38-15-13-34/h1-2,9-11,16,19,21-22H,3-8,12-15,17-18H2,(H,32,33) |
| InChIKey | KDYSCIAFTSBCNQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |