C27H35F3N6O2 — CID 162575802
N-[4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-N-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)hydroxylamine (PubChem CID 162575802) has the molecular formula C27H35F3N6O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is N-[4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-N-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)hydroxylamine.
| Compound Name | N-[4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-N-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)hydroxylamine |
|---|---|
| PubChem CID | 162575802 |
| Molecular Formula | C27H35F3N6O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | N-[4-[cyclopropyl(2,2,2-trifluoroethyl)amino]cyclohexyl]-N-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)hydroxylamine |
| SMILES | ON(C1CCC(N(CC(F)(F)F)C2CC2)CC1)N1Cc2cccnc2Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C27H35F3N6O2/c28-27(29,30)18-34(20-3-4-20)21-5-7-22(8-6-21)36(37)35-17-19-2-1-11-31-26(19)32-24-10-9-23(16-25(24)35)33-12-14-38-15-13-33/h1-2,9-11,16,20-22,37H,3-8,12-15,17-18H2,(H,31,32) |
| InChIKey | KIWZCMMBTHOKTE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|