C24H29F3N4O2 — CID 145094748
7,7,7-trifluoro-2-methyl-1-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)heptan-1-one (PubChem CID 145094748) has the molecular formula C24H29F3N4O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 7,7,7-trifluoro-2-methyl-1-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)heptan-1-one.
| Compound Name | 7,7,7-trifluoro-2-methyl-1-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)heptan-1-one |
|---|---|
| PubChem CID | 145094748 |
| Molecular Formula | C24H29F3N4O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 7,7,7-trifluoro-2-methyl-1-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)heptan-1-one |
| SMILES | CC(CCCCC(F)(F)F)C(=O)N1Cc2cccnc2Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C24H29F3N4O2/c1-17(5-2-3-9-24(25,26)27)23(32)31-16-18-6-4-10-28-22(18)29-20-8-7-19(15-21(20)31)30-11-13-33-14-12-30/h4,6-8,10,15,17H,2-3,5,9,11-14,16H2,1H3,(H,28,29) |
| InChIKey | JLODFHWIBCUTAH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|