C27H33F2N5O2 — CID 121389634
[4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone (PubChem CID 121389634) has the molecular formula C27H33F2N5O2 and a molecular weight of 497.59 g/mol. Its IUPAC name is [4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone.
| Compound Name | [4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
|---|---|
| PubChem CID | 121389634 |
| Molecular Formula | C27H33F2N5O2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | [4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
| SMILES | O=C(C1CCC(N2C[C@H](F)[C@@H](F)C2)CC1)N1Cc2cccnc2Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C27H33F2N5O2/c28-22-16-33(17-23(22)29)20-5-3-18(4-6-20)27(35)34-15-19-2-1-9-30-26(19)31-24-8-7-21(14-25(24)34)32-10-12-36-13-11-32/h1-2,7-9,14,18,20,22-23H,3-6,10-13,15-17H2,(H,30,31)/t18?,20?,22-,23-/m0/s1 |
| InChIKey | KUBURIZMRQKCDR-FRZIOBBBSA-N |
| XLogP | 4.06 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |