C26H31F3N4O2 — CID 146174900
[(1R,3S,4R)-4-ethyl-3-(trifluoromethyl)cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone (PubChem CID 146174900) has the molecular formula C26H31F3N4O2 and a molecular weight of 488.55 g/mol. Its IUPAC name is [(1R,3S,4R)-4-ethyl-3-(trifluoromethyl)cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone.
| Compound Name | [(1R,3S,4R)-4-ethyl-3-(trifluoromethyl)cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
|---|---|
| PubChem CID | 146174900 |
| Molecular Formula | C26H31F3N4O2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [(1R,3S,4R)-4-ethyl-3-(trifluoromethyl)cyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
| SMILES | CC[C@@H]1CC[C@@H](C(=O)N2Cc3cccnc3Nc3ccc(N4CCOCC4)cc32)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C26H31F3N4O2/c1-2-17-5-6-18(14-21(17)26(27,28)29)25(34)33-16-19-4-3-9-30-24(19)31-22-8-7-20(15-23(22)33)32-10-12-35-13-11-32/h3-4,7-9,15,17-18,21H,2,5-6,10-14,16H2,1H3,(H,30,31)/t17-,18-,21+/m1/s1 |
| InChIKey | OVOWKVRWNJRBCB-OPYAIIAOSA-N |
| XLogP | 5.51 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |