C27H36N4O2 — CID 146175039
[(1R,2S,4R,5S)-4-ethyl-2,5-dimethylcyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone (PubChem CID 146175039) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-4-ethyl-2,5-dimethylcyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone.
| Compound Name | [(1R,2S,4R,5S)-4-ethyl-2,5-dimethylcyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
|---|---|
| PubChem CID | 146175039 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [(1R,2S,4R,5S)-4-ethyl-2,5-dimethylcyclohexyl]-(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)methanone |
| SMILES | CC[C@@H]1C[C@H](C)[C@H](C(=O)N2Cc3cccnc3Nc3ccc(N4CCOCC4)cc32)C[C@@H]1C |
| InChI | InChI=1S/C27H36N4O2/c1-4-20-14-19(3)23(15-18(20)2)27(32)31-17-21-6-5-9-28-26(21)29-24-8-7-22(16-25(24)31)30-10-12-33-13-11-30/h5-9,16,18-20,23H,4,10-15,17H2,1-3H3,(H,28,29)/t18-,19-,20+,23+/m0/s1 |
| InChIKey | VSCFLZVKKZWCIM-XFGYDDDFSA-N |
| XLogP | 5.22 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |