C16H17N5O2 — CID 145094922
4-(6-nitroso-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)morpholine (PubChem CID 145094922) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 4-(6-nitroso-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)morpholine.
| Compound Name | 4-(6-nitroso-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)morpholine |
|---|---|
| PubChem CID | 145094922 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-(6-nitroso-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-8-yl)morpholine |
| SMILES | O=NN1Cc2cccnc2Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C16H17N5O2/c22-19-21-11-12-2-1-5-17-16(12)18-14-4-3-13(10-15(14)21)20-6-8-23-9-7-20/h1-5,10H,6-9,11H2,(H,17,18) |
| InChIKey | LVFVWFNEDYZNPJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|